C8H15NO — CID 95735292
1-[(2R,3S)-3-methylpiperidin-2-yl]ethanone (PubChem CID 95735292) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-[(2R,3S)-3-methylpiperidin-2-yl]ethanone.
| Compound Name | 1-[(2R,3S)-3-methylpiperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 95735292 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-[(2R,3S)-3-methylpiperidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1NCCC[C@@H]1C |
| InChI | InChI=1S/C8H15NO/c1-6-4-3-5-9-8(6)7(2)10/h6,8-9H,3-5H2,1-2H3/t6-,8+/m0/s1 |
| InChIKey | QVRPZVLGVSNFDF-POYBYMJQSA-N |
| XLogP | 0.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |