C15H15N3 — CID 62339520
N-[(2-methylpyrimidin-4-yl)methyl]-3-phenylprop-2-yn-1-amine (PubChem CID 62339520) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is N-[(2-methylpyrimidin-4-yl)methyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[(2-methylpyrimidin-4-yl)methyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 62339520 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-[(2-methylpyrimidin-4-yl)methyl]-3-phenylprop-2-yn-1-amine |
| SMILES | Cc1nccc(CNCC#Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3/c1-13-17-11-9-15(18-13)12-16-10-5-8-14-6-3-2-4-7-14/h2-4,6-7,9,11,16H,10,12H2,1H3 |
| InChIKey | RDZREJVDTVDRAI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|