C12H11N3O — CID 106399101
N-(1,2,4-oxadiazol-3-ylmethyl)-3-phenylprop-2-yn-1-amine (PubChem CID 106399101) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-3-phenylprop-2-yn-1-amine.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 106399101 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-3-phenylprop-2-yn-1-amine |
| SMILES | C(#Cc1ccccc1)CNCc1ncon1 |
| InChI | InChI=1S/C12H11N3O/c1-2-5-11(6-3-1)7-4-8-13-9-12-14-10-16-15-12/h1-3,5-6,10,13H,8-9H2 |
| InChIKey | NXSOQJDVEBQPPQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|