C14H14N2O — CID 62340525
N-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-phenylprop-2-yn-1-amine (PubChem CID 62340525) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 62340525 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-phenylprop-2-yn-1-amine |
| SMILES | Cc1cc(CNCC#Cc2ccccc2)on1 |
| InChI | InChI=1S/C14H14N2O/c1-12-10-14(17-16-12)11-15-9-5-8-13-6-3-2-4-7-13/h2-4,6-7,10,15H,9,11H2,1H3 |
| InChIKey | ROEIZIMSUWFDAQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|