C11H10F2N2 — CID 62339580
2,3-difluoro-N-(1H-pyrrol-2-ylmethyl)aniline (PubChem CID 62339580) has the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2,3-difluoro-N-(1H-pyrrol-2-ylmethyl)aniline.
| Compound Name | 2,3-difluoro-N-(1H-pyrrol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 62339580 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2,3-difluoro-N-(1H-pyrrol-2-ylmethyl)aniline |
| SMILES | Fc1cccc(NCc2ccc[nH]2)c1F |
| InChI | InChI=1S/C11H10F2N2/c12-9-4-1-5-10(11(9)13)15-7-8-3-2-6-14-8/h1-6,14-15H,7H2 |
| InChIKey | HNFNPZFMBCPXGK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |