C14H14FN3O2 — CID 99605413
N'-(2-fluoro-3-methylphenyl)-N-(1H-pyrrol-2-ylmethyl)oxamide (PubChem CID 99605413) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is N'-(2-fluoro-3-methylphenyl)-N-(1H-pyrrol-2-ylmethyl)oxamide.
| Compound Name | N'-(2-fluoro-3-methylphenyl)-N-(1H-pyrrol-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 99605413 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N'-(2-fluoro-3-methylphenyl)-N-(1H-pyrrol-2-ylmethyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCc2ccc[nH]2)c1F |
| InChI | InChI=1S/C14H14FN3O2/c1-9-4-2-6-11(12(9)15)18-14(20)13(19)17-8-10-5-3-7-16-10/h2-7,16H,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | WDWKPASOVNMQOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|