C11H13N3OS — CID 62344427
4-piperidin-4-yloxythieno[3,2-d]pyrimidine (PubChem CID 62344427) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-piperidin-4-yloxythieno[3,2-d]pyrimidine.
| Compound Name | 4-piperidin-4-yloxythieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 62344427 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-piperidin-4-yloxythieno[3,2-d]pyrimidine |
| SMILES | c1nc(OC2CCNCC2)c2sccc2n1 |
| InChI | InChI=1S/C11H13N3OS/c1-4-12-5-2-8(1)15-11-10-9(3-6-16-10)13-7-14-11/h3,6-8,12H,1-2,4-5H2 |
| InChIKey | TUYFUZLFLGKJID-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |