methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate

C15H16FNO2S — CID 62347183

IUPACmethyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate
SMILESCCc1ccc(C(Nc2ccccc2F)C(=O)OC)s1
InChIInChI=1S/C15H16FNO2S/c1-3-10-8-9-13(20-10)14(15(18)19-2)17-12-7-5-4-6-11(12)16/h4-9,14,17H,3H2,1-2H3
InChIKeyUMPYLWXLQGXLPH-UHFFFAOYSA-N
MW293.36 g/mol
LogP3.78
Rot. Bonds5

About methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate

methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate (PubChem CID 62347183) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate
PubChem CID62347183
Molecular FormulaC15H16FNO2S
Molecular Weight293.36 g/mol
Exact Mass293.09
IUPAC Namemethyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate
SMILESCCc1ccc(C(Nc2ccccc2F)C(=O)OC)s1
InChIInChI=1S/C15H16FNO2S/c1-3-10-8-9-13(20-10)14(15(18)19-2)17-12-7-5-4-6-11(12)16/h4-9,14,17H,3H2,1-2H3
InChIKeyUMPYLWXLQGXLPH-UHFFFAOYSA-N
XLogP3.78
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.36
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate?
The IUPAC name of methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate (CID 62347183) is methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate.
What is the SMILES notation for methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate?
The canonical SMILES for methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate is CCc1ccc(C(Nc2ccccc2F)C(=O)OC)s1.
What is the InChIKey of methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate?
The InChIKey is UMPYLWXLQGXLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2S/c1-3-10-8-9-13(20-10)14(15(18)19-2)17-12-7-5-4-6-11(12)16/h4-9,14,17H,3H2,1-2H3.
What are the key properties of methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate?
methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate has a molecular weight of 293.36 g/mol, XLogP of 3.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-ethylthiophen-2-yl)-2-(2-fluoroanilino)acetate is sourced from PubChem (CID 62347183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).