3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid

C11H19N3O2 — CID 62350091

IUPAC3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid
SMILESCCCNC(Cn1cnc(C)c1C)C(=O)O
InChIInChI=1S/C11H19N3O2/c1-4-5-12-10(11(15)16)6-14-7-13-8(2)9(14)3/h7,10,12H,4-6H2,1-3H3,(H,15,16)
InChIKeyGDHJKCFUFDRCLV-UHFFFAOYSA-N
MW225.29 g/mol
LogP0.95
Rot. Bonds6

About 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid

3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid (PubChem CID 62350091) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid.

Molecular Properties

Compound Name3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid
PubChem CID62350091
Molecular FormulaC11H19N3O2
Molecular Weight225.29 g/mol
Exact Mass225.15
IUPAC Name3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid
SMILESCCCNC(Cn1cnc(C)c1C)C(=O)O
InChIInChI=1S/C11H19N3O2/c1-4-5-12-10(11(15)16)6-14-7-13-8(2)9(14)3/h7,10,12H,4-6H2,1-3H3,(H,15,16)
InChIKeyGDHJKCFUFDRCLV-UHFFFAOYSA-N
XLogP0.95
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.29
LogP ≤ 50.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid (CID 62350091) is 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid is CCCNC(Cn1cnc(C)c1C)C(=O)O.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid?
The InChIKey is GDHJKCFUFDRCLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-4-5-12-10(11(15)16)6-14-7-13-8(2)9(14)3/h7,10,12H,4-6H2,1-3H3,(H,15,16).
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid?
3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid has a molecular weight of 225.29 g/mol, XLogP of 0.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)-2-(propylamino)propanoic acid is sourced from PubChem (CID 62350091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).