C11H19N3 — CID 62351594
[2-(4,5-dimethylimidazol-1-yl)cyclopentyl]methanamine (PubChem CID 62351594) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is [2-(4,5-dimethylimidazol-1-yl)cyclopentyl]methanamine.
| Compound Name | [2-(4,5-dimethylimidazol-1-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 62351594 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | [2-(4,5-dimethylimidazol-1-yl)cyclopentyl]methanamine |
| SMILES | Cc1ncn(C2CCCC2CN)c1C |
| InChI | InChI=1S/C11H19N3/c1-8-9(2)14(7-13-8)11-5-3-4-10(11)6-12/h7,10-11H,3-6,12H2,1-2H3 |
| InChIKey | UBXGQCCAJRDDEH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |