C11H12N4O2S — CID 62353333
N-[5-(aminomethyl)-2-pyridinyl]pyridine-3-sulfonamide (PubChem CID 62353333) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is N-[5-(aminomethyl)-2-pyridinyl]pyridine-3-sulfonamide.
| Compound Name | N-[5-(aminomethyl)-2-pyridinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62353333 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[5-(aminomethyl)-2-pyridinyl]pyridine-3-sulfonamide |
| SMILES | NCc1ccc(NS(=O)(=O)c2cccnc2)nc1 |
| InChI | InChI=1S/C11H12N4O2S/c12-6-9-3-4-11(14-7-9)15-18(16,17)10-2-1-5-13-8-10/h1-5,7-8H,6,12H2,(H,14,15) |
| InChIKey | ZRSDJXBXUPILIP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |