C10H13N5O2S — CID 62353719
N-[5-(aminomethyl)-2-pyridinyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 62353719) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-[5-(aminomethyl)-2-pyridinyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[5-(aminomethyl)-2-pyridinyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62353719 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-[5-(aminomethyl)-2-pyridinyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(CN)cn2)cn1 |
| InChI | InChI=1S/C10H13N5O2S/c1-15-7-9(6-13-15)18(16,17)14-10-3-2-8(4-11)5-12-10/h2-3,5-7H,4,11H2,1H3,(H,12,14) |
| InChIKey | YHAQSHZSGWBHCP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |