C9H11N5O2S — CID 62062956
N-(5-amino-2-pyridinyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 62062956) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62062956 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(N)cn2)cn1 |
| InChI | InChI=1S/C9H11N5O2S/c1-14-6-8(5-12-14)17(15,16)13-9-3-2-7(10)4-11-9/h2-6H,10H2,1H3,(H,11,13) |
| InChIKey | LOWOFPUPBUGUAK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |