C12H10N2O2 — CID 62354497
6-hydroxy-3-(prop-2-ynylamino)-2H-1-benzofuran-3-carbonitrile (PubChem CID 62354497) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-hydroxy-3-(prop-2-ynylamino)-2H-1-benzofuran-3-carbonitrile.
| Compound Name | 6-hydroxy-3-(prop-2-ynylamino)-2H-1-benzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 62354497 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-hydroxy-3-(prop-2-ynylamino)-2H-1-benzofuran-3-carbonitrile |
| SMILES | C#CCNC1(C#N)COc2cc(O)ccc21 |
| InChI | InChI=1S/C12H10N2O2/c1-2-5-14-12(7-13)8-16-11-6-9(15)3-4-10(11)12/h1,3-4,6,14-15H,5,8H2 |
| InChIKey | IHAQTTFOHOZZRV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|