C23H19N3O3 — CID 6235718
1-(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 6235718) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 6235718 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H19N3O3/c27-22(26-12-6-11-19(26)23(28)29)18-13-16-15-9-4-5-10-17(15)24-21(16)20(25-18)14-7-2-1-3-8-14/h1-5,7-10,13,19,24H,6,11-12H2,(H,28,29) |
| InChIKey | FWQCTXBWEJGNJF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |