C14H19N3S — CID 62358053
3-[2-(2-thiophen-2-ylimidazol-1-yl)ethyl]piperidine (PubChem CID 62358053) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-[2-(2-thiophen-2-ylimidazol-1-yl)ethyl]piperidine.
| Compound Name | 3-[2-(2-thiophen-2-ylimidazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 62358053 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[2-(2-thiophen-2-ylimidazol-1-yl)ethyl]piperidine |
| SMILES | c1csc(-c2nccn2CCC2CCCNC2)c1 |
| InChI | InChI=1S/C14H19N3S/c1-3-12(11-15-6-1)5-8-17-9-7-16-14(17)13-4-2-10-18-13/h2,4,7,9-10,12,15H,1,3,5-6,8,11H2 |
| InChIKey | OVIHPHUTHRMAHA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |