C7H15N3O2S — CID 62360080
1-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine (PubChem CID 62360080) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 62360080 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15N3O2S/c1-9-7(8)10-4-6-2-3-13(11,12)5-6/h6H,2-5H2,1H3,(H3,8,9,10) |
| InChIKey | CASNHSSHHIWFIJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|