C16H23N3 — CID 62361606
N'-cyclopentyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboximidamide (PubChem CID 62361606) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N'-cyclopentyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboximidamide.
| Compound Name | N'-cyclopentyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 62361606 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N'-cyclopentyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboximidamide |
| SMILES | Cc1ccc2c(c1)CCCN2/C(N)=N/C1CCCC1 |
| InChI | InChI=1S/C16H23N3/c1-12-8-9-15-13(11-12)5-4-10-19(15)16(17)18-14-6-2-3-7-14/h8-9,11,14H,2-7,10H2,1H3,(H2,17,18) |
| InChIKey | GJPKPJXQWFKRBF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|