C17H22N2OS — CID 80591610
3-methyl-1-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)cyclobutane-1-carbothioamide (PubChem CID 80591610) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-methyl-1-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)cyclobutane-1-carbothioamide.
| Compound Name | 3-methyl-1-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)cyclobutane-1-carbothioamide |
|---|---|
| PubChem CID | 80591610 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-methyl-1-(6-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)cyclobutane-1-carbothioamide |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)C1(C(N)=S)CC(C)C1 |
| InChI | InChI=1S/C17H22N2OS/c1-11-5-6-14-13(8-11)4-3-7-19(14)16(20)17(15(18)21)9-12(2)10-17/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H2,18,21) |
| InChIKey | ZFPAWMJPMUJYLX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|