C10H21N3O — CID 62362113
4-ethoxy-N'-ethylpiperidine-1-carboximidamide (PubChem CID 62362113) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-ethoxy-N'-ethylpiperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-ethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 62362113 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 4-ethoxy-N'-ethylpiperidine-1-carboximidamide |
| SMILES | CC/N=C(\N)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-3-12-10(11)13-7-5-9(6-8-13)14-4-2/h9H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | XERQINOPPHAWAD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|