C11H21F3IN3O — CID 111057751
N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111057751) has the molecular formula C11H21F3IN3O and a molecular weight of 395.21 g/mol. Its IUPAC name is N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111057751 |
| Molecular Formula | C11H21F3IN3O |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCOCC(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C11H20F3N3O.HI/c12-11(13,14)9-18-8-4-5-16-10(15)17-6-2-1-3-7-17;/h1-9H2,(H2,15,16);1H |
| InChIKey | WRJYWVJQWZHEFO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|