C10H19F3IN3O2 — CID 111057667
N'-[3-(2,2,2-trifluoroethoxy)propyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111057667) has the molecular formula C10H19F3IN3O2 and a molecular weight of 397.18 g/mol. Its IUPAC name is N'-[3-(2,2,2-trifluoroethoxy)propyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(2,2,2-trifluoroethoxy)propyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111057667 |
| Molecular Formula | C10H19F3IN3O2 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N'-[3-(2,2,2-trifluoroethoxy)propyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCOCC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C10H18F3N3O2.HI/c11-10(12,13)8-18-5-1-2-15-9(14)16-3-6-17-7-4-16;/h1-8H2,(H2,14,15);1H |
| InChIKey | GAGZHYOAXWJFHZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|