C12H23F3IN3O — CID 111057715
3-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111057715) has the molecular formula C12H23F3IN3O and a molecular weight of 409.23 g/mol. Its IUPAC name is 3-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111057715 |
| Molecular Formula | C12H23F3IN3O |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 3-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/CCCOCC(F)(F)F)C1.I |
| InChI | InChI=1S/C12H22F3N3O.HI/c1-10-4-2-6-18(8-10)11(16)17-5-3-7-19-9-12(13,14)15;/h10H,2-9H2,1H3,(H2,16,17);1H |
| InChIKey | RSFOLROLYIKCDP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|