C12H22F3N3O — CID 100667955
4-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide (PubChem CID 100667955) has the molecular formula C12H22F3N3O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 100667955 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-methyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3O/c1-10-3-6-18(7-4-10)11(16)17-5-2-8-19-9-12(13,14)15/h10H,2-9H2,1H3,(H2,16,17) |
| InChIKey | SWLSZIAXEXMPPZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|