C11H18F3N3 — CID 62362297
2-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62362297) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 2-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 62362297 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-cyclopentyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\C1CCCC1)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H18F3N3/c12-11(13,14)7-17(9-5-6-9)10(15)16-8-3-1-2-4-8/h8-9H,1-7H2,(H2,15,16) |
| InChIKey | GCKXNRAFPNITCQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|