C11H20F3N3 — CID 62362521
2-cyclopentyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62362521) has the molecular formula C11H20F3N3 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-cyclopentyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 2-cyclopentyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 62362521 |
| Molecular Formula | C11H20F3N3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-cyclopentyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CCCN(CC(F)(F)F)/C(N)=N/C1CCCC1 |
| InChI | InChI=1S/C11H20F3N3/c1-2-7-17(8-11(12,13)14)10(15)16-9-5-3-4-6-9/h9H,2-8H2,1H3,(H2,15,16) |
| InChIKey | JQGVWYWRCMTIFF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|