C13H27F2N5 — CID 170130623
1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine (PubChem CID 170130623) has the molecular formula C13H27F2N5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine.
| Compound Name | 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine |
|---|---|
| PubChem CID | 170130623 |
| Molecular Formula | C13H27F2N5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H]1CCC(N(C)CC(F)(F)CCNC)C1 |
| InChI | InChI=1S/C13H27F2N5/c1-17-7-6-13(14,15)9-20(3)11-5-4-10(8-11)19-12(16)18-2/h10-11,17H,4-9H2,1-3H3,(H3,16,18,19)/t10-,11?/m0/s1 |
| InChIKey | ZLYKNMHFAYRPLV-VUWPPUDQSA-N |
| XLogP | 0.62 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|