About 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine
1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine (PubChem CID 170130623) has the molecular formula C13H27F2N5
and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine.
Molecular Properties
| Compound Name | 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine |
| PubChem CID | 170130623 |
| Molecular Formula | C13H27F2N5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H]1CCC(N(C)CC(F)(F)CCNC)C1 |
| InChI | InChI=1S/C13H27F2N5/c1-17-7-6-13(14,15)9-20(3)11-5-4-10(8-11)19-12(16)18-2/h10-11,17H,4-9H2,1-3H3,(H3,16,18,19)/t10-,11?/m0/s1 |
| InChIKey | ZLYKNMHFAYRPLV-VUWPPUDQSA-N |
| XLogP | 0.62 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine?
The IUPAC name of 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine (CID 170130623) is 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine.
What is the SMILES notation for 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine?
The canonical SMILES for 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine is C/N=C(\N)N[C@H]1CCC(N(C)CC(F)(F)CCNC)C1.
What is the InChIKey of 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine?
The InChIKey is ZLYKNMHFAYRPLV-VUWPPUDQSA-N. The full InChI is InChI=1S/C13H27F2N5/c1-17-7-6-13(14,15)9-20(3)11-5-4-10(8-11)19-12(16)18-2/h10-11,17H,4-9H2,1-3H3,(H3,16,18,19)/t10-,11?/m0/s1.
What are the key properties of 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine?
1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine has a molecular weight of 291.39 g/mol, XLogP of 0.62, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-3-[[2,2-difluoro-4-(methylamino)butyl]-methylamino]cyclopentyl]-2-methylguanidine is sourced from PubChem (CID 170130623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).