C10H18F3N3 — CID 79038738
1-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine (PubChem CID 79038738) has the molecular formula C10H18F3N3 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine.
| Compound Name | 1-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine |
|---|---|
| PubChem CID | 79038738 |
| Molecular Formula | C10H18F3N3 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine |
| SMILES | N/C(=N\CCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C10H18F3N3/c11-10(12,13)6-3-7-15-9(14)16-8-4-1-2-5-8/h8H,1-7H2,(H3,14,15,16) |
| InChIKey | KPPHUKAEVZYTPM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|