About 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine
1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 63227578) has the molecular formula C10H18F3N3
and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine |
| PubChem CID | 63227578 |
| Molecular Formula | C10H18F3N3 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | N/C(=N\CCC(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C10H18F3N3/c11-10(12,13)6-7-15-9(14)16-8-4-2-1-3-5-8/h8H,1-7H2,(H3,14,15,16) |
| InChIKey | UVWLJIAGWMSXOE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine?
The IUPAC name of 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine (CID 63227578) is 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine.
What is the SMILES notation for 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine?
The canonical SMILES for 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine is N/C(=N\CCC(F)(F)F)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine?
The InChIKey is UVWLJIAGWMSXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3/c11-10(12,13)6-7-15-9(14)16-8-4-2-1-3-5-8/h8H,1-7H2,(H3,14,15,16).
What are the key properties of 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine?
1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine has a molecular weight of 237.27 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(3,3,3-trifluoropropyl)guanidine is sourced from PubChem (CID 63227578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).