C8H17N3O2S — CID 62362659
1-cyclopropyl-2-(3-methylsulfonylpropyl)guanidine (PubChem CID 62362659) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 62362659 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-cyclopropyl-2-(3-methylsulfonylpropyl)guanidine |
| SMILES | CS(=O)(=O)CCC/N=C(\N)NC1CC1 |
| InChI | InChI=1S/C8H17N3O2S/c1-14(12,13)6-2-5-10-8(9)11-7-3-4-7/h7H,2-6H2,1H3,(H3,9,10,11) |
| InChIKey | CGCQBVCHSKKVNQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|