C11H20N4 — CID 62363225
N',4-dicyclopropylpiperazine-1-carboximidamide (PubChem CID 62363225) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N',4-dicyclopropylpiperazine-1-carboximidamide.
| Compound Name | N',4-dicyclopropylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 62363225 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N',4-dicyclopropylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\C1CC1)N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C11H20N4/c12-11(13-9-1-2-9)15-7-5-14(6-8-15)10-3-4-10/h9-10H,1-8H2,(H2,12,13) |
| InChIKey | YZHKESRMJXXLOL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|