C8H13F2N3 — CID 130690545
N'-cyclopropyl-3,3-difluoropyrrolidine-1-carboximidamide (PubChem CID 130690545) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N'-cyclopropyl-3,3-difluoropyrrolidine-1-carboximidamide.
| Compound Name | N'-cyclopropyl-3,3-difluoropyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 130690545 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N'-cyclopropyl-3,3-difluoropyrrolidine-1-carboximidamide |
| SMILES | N/C(=N\C1CC1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C8H13F2N3/c9-8(10)3-4-13(5-8)7(11)12-6-1-2-6/h6H,1-5H2,(H2,11,12) |
| InChIKey | YMNIGINIWRJSBK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|