C11H20F2IN3 — CID 120514505
N'-(3,3-difluorocyclobutyl)azepane-1-carboximidamide;hydroiodide (PubChem CID 120514505) has the molecular formula C11H20F2IN3 and a molecular weight of 359.20 g/mol. Its IUPAC name is N'-(3,3-difluorocyclobutyl)azepane-1-carboximidamide;hydroiodide.
| Compound Name | N'-(3,3-difluorocyclobutyl)azepane-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120514505 |
| Molecular Formula | C11H20F2IN3 |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N'-(3,3-difluorocyclobutyl)azepane-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\C1CC(F)(F)C1)N1CCCCCC1 |
| InChI | InChI=1S/C11H19F2N3.HI/c12-11(13)7-9(8-11)15-10(14)16-5-3-1-2-4-6-16;/h9H,1-8H2,(H2,14,15);1H |
| InChIKey | DVGZEKVPTQHFNL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|