C13H24ClF2N5 — CID 176542819
N-(N'-cyclohexylcarbamimidoyl)-4,4-difluoropiperidine-1-carboximidamide;hydrochloride (PubChem CID 176542819) has the molecular formula C13H24ClF2N5 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-(N'-cyclohexylcarbamimidoyl)-4,4-difluoropiperidine-1-carboximidamide;hydrochloride.
| Compound Name | N-(N'-cyclohexylcarbamimidoyl)-4,4-difluoropiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 176542819 |
| Molecular Formula | C13H24ClF2N5 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(N'-cyclohexylcarbamimidoyl)-4,4-difluoropiperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N/C(N)=N/C1CCCCC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2N5.ClH/c14-13(15)6-8-20(9-7-13)12(17)19-11(16)18-10-4-2-1-3-5-10;/h10H,1-9H2,(H4,16,17,18,19);1H |
| InChIKey | BBTYKSAFSJFXIB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|