C7H17N5O4S — CID 176517926
1-carbamimidoyl-2-cyclopentylguanidine;sulfuric acid (PubChem CID 176517926) has the molecular formula C7H17N5O4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-carbamimidoyl-2-cyclopentylguanidine;sulfuric acid.
| Compound Name | 1-carbamimidoyl-2-cyclopentylguanidine;sulfuric acid |
|---|---|
| PubChem CID | 176517926 |
| Molecular Formula | C7H17N5O4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-carbamimidoyl-2-cyclopentylguanidine;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(\N)N/C(N)=N/C1CCCC1 |
| InChI | InChI=1S/C7H15N5.H2O4S/c8-6(9)12-7(10)11-5-3-1-2-4-5;1-5(2,3)4/h5H,1-4H2,(H6,8,9,10,11,12);(H2,1,2,3,4) |
| InChIKey | SCQHJSFQFJTDKJ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|