C6H13N5 — CID 176547008
1-carbamimidoyl-2-(2-methylcyclopropyl)guanidine (PubChem CID 176547008) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-carbamimidoyl-2-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 176547008 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 1-carbamimidoyl-2-(2-methylcyclopropyl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/C1CC1C |
| InChI | InChI=1S/C6H13N5/c1-3-2-4(3)10-6(9)11-5(7)8/h3-4H,2H2,1H3,(H6,7,8,9,10,11) |
| InChIKey | BYPNQNDLUXPUBY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|