C9H20N6 — CID 176546957
1-carbamimidoyl-2-(1-ethylpiperidin-4-yl)guanidine (PubChem CID 176546957) has the molecular formula C9H20N6 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(1-ethylpiperidin-4-yl)guanidine.
| Compound Name | 1-carbamimidoyl-2-(1-ethylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 176546957 |
| Molecular Formula | C9H20N6 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 1-carbamimidoyl-2-(1-ethylpiperidin-4-yl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/C1CCN(CC)CC1 |
| InChI | InChI=1S/C9H20N6/c1-2-15-5-3-7(4-6-15)13-9(12)14-8(10)11/h7H,2-6H2,1H3,(H6,10,11,12,13,14) |
| InChIKey | JXYOSSDRZBMJBY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|