C9H19N5 — CID 176546318
3-(N'-cyclopentylcarbamimidoyl)-1,1-dimethylguanidine (PubChem CID 176546318) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 3-(N'-cyclopentylcarbamimidoyl)-1,1-dimethylguanidine.
| Compound Name | 3-(N'-cyclopentylcarbamimidoyl)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 176546318 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 3-(N'-cyclopentylcarbamimidoyl)-1,1-dimethylguanidine |
| SMILES | [H]/N=C(/N/C(N)=N/C1CCCC1)N(C)C |
| InChI | InChI=1S/C9H19N5/c1-14(2)9(11)13-8(10)12-7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H4,10,11,12,13) |
| InChIKey | OEMDRHPZYLZRKL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|