C6H11F2N5 — CID 176530591
1-carbamimidoyl-2-(3,3-difluorocyclobutyl)guanidine (PubChem CID 176530591) has the molecular formula C6H11F2N5 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(3,3-difluorocyclobutyl)guanidine.
| Compound Name | 1-carbamimidoyl-2-(3,3-difluorocyclobutyl)guanidine |
|---|---|
| PubChem CID | 176530591 |
| Molecular Formula | C6H11F2N5 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 1-carbamimidoyl-2-(3,3-difluorocyclobutyl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/C1CC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2N5/c7-6(8)1-3(2-6)12-5(11)13-4(9)10/h3H,1-2H2,(H6,9,10,11,12,13) |
| InChIKey | GTGSBHJXKPBZNM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|