C9H21N5 — CID 123297716
2-[1-[2-(methylamino)ethyl]piperidin-4-yl]guanidine (PubChem CID 123297716) has the molecular formula C9H21N5 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-[1-[2-(methylamino)ethyl]piperidin-4-yl]guanidine.
| Compound Name | 2-[1-[2-(methylamino)ethyl]piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 123297716 |
| Molecular Formula | C9H21N5 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 2-[1-[2-(methylamino)ethyl]piperidin-4-yl]guanidine |
| SMILES | CNCCN1CCC(N=C(N)N)CC1 |
| InChI | InChI=1S/C9H21N5/c1-12-4-7-14-5-2-8(3-6-14)13-9(10)11/h8,12H,2-7H2,1H3,(H4,10,11,13) |
| InChIKey | JXYLYEMMWUFDQQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|