C15H23F2N5 — CID 176541394
3,3-difluoro-N-[N'-(6-propylcyclohexa-2,4-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 176541394) has the molecular formula C15H23F2N5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3,3-difluoro-N-[N'-(6-propylcyclohexa-2,4-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3,3-difluoro-N-[N'-(6-propylcyclohexa-2,4-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 176541394 |
| Molecular Formula | C15H23F2N5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3,3-difluoro-N-[N'-(6-propylcyclohexa-2,4-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(/N/C(N)=N/C1C=CC=CC1CCC)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H23F2N5/c1-2-5-11-6-3-4-7-12(11)20-13(18)21-14(19)22-9-8-15(16,17)10-22/h3-4,6-7,11-12H,2,5,8-10H2,1H3,(H4,18,19,20,21) |
| InChIKey | DAEQUWWTYHBPIQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|