C10H17N3S — CID 62363953
2-propyl-1-(1-thiophen-2-ylethyl)guanidine (PubChem CID 62363953) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-propyl-1-(1-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-propyl-1-(1-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 62363953 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-propyl-1-(1-thiophen-2-ylethyl)guanidine |
| SMILES | CCC/N=C(\N)NC(C)c1cccs1 |
| InChI | InChI=1S/C10H17N3S/c1-3-6-12-10(11)13-8(2)9-5-4-7-14-9/h4-5,7-8H,3,6H2,1-2H3,(H3,11,12,13) |
| InChIKey | KMQLYOZSQJTTNN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|