C10H18F3N3 — CID 62364122
2-Tert-butyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62364122) has the molecular formula C10H18F3N3 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-tert-butyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 2-Tert-butyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 62364122 |
| Molecular Formula | C10H18F3N3 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-tert-butyl-1-cyclopropyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CC(C)(C)N=C(N)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H18F3N3/c1-9(2,3)15-8(14)16(7-4-5-7)6-10(11,12)13/h7H,4-6H2,1-3H3,(H2,14,15) |
| InChIKey | ZAPHSCBILIZTPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 274 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|