C7H12F3N3 — CID 62358421
1-cyclopropyl-2-methyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62358421) has the molecular formula C7H12F3N3 and a molecular weight of 195.19 g/mol. Its IUPAC name is 1-cyclopropyl-2-methyl-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-cyclopropyl-2-methyl-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 62358421 |
| Molecular Formula | C7H12F3N3 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-cyclopropyl-2-methyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | C/N=C(\N)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C7H12F3N3/c1-12-6(11)13(5-2-3-5)4-7(8,9)10/h5H,2-4H2,1H3,(H2,11,12) |
| InChIKey | QTTRFRSKIJUJKD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|