C9H14F3N3O2 — CID 55008888
2-amino-N-cyclopropyl-N-(2,2,2-trifluoroethyl)butanediamide (PubChem CID 55008888) has the molecular formula C9H14F3N3O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-N-(2,2,2-trifluoroethyl)butanediamide.
| Compound Name | 2-amino-N-cyclopropyl-N-(2,2,2-trifluoroethyl)butanediamide |
|---|---|
| PubChem CID | 55008888 |
| Molecular Formula | C9H14F3N3O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-amino-N-cyclopropyl-N-(2,2,2-trifluoroethyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C9H14F3N3O2/c10-9(11,12)4-15(5-1-2-5)8(17)6(13)3-7(14)16/h5-6H,1-4,13H2,(H2,14,16) |
| InChIKey | ORRMVXZWWPCPLZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |