C7H12F3N3O — CID 76912585
2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxyethanimidamide (PubChem CID 76912585) has the molecular formula C7H12F3N3O and a molecular weight of 211.19 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 76912585 |
| Molecular Formula | C7H12F3N3O |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)amino]-N'-hydroxyethanimidamide |
| SMILES | NC(CN(CC(F)(F)F)C1CC1)=NO |
| InChI | InChI=1S/C7H12F3N3O/c8-7(9,10)4-13(5-1-2-5)3-6(11)12-14/h5,14H,1-4H2,(H2,11,12) |
| InChIKey | JFMSDLRMEYCBEA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|