C14H14F3NO3 — CID 62365998
ethyl 2-(prop-2-ynylamino)-2-[4-(trifluoromethoxy)phenyl]acetate (PubChem CID 62365998) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is ethyl 2-(prop-2-ynylamino)-2-[4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-(prop-2-ynylamino)-2-[4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 62365998 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl 2-(prop-2-ynylamino)-2-[4-(trifluoromethoxy)phenyl]acetate |
| SMILES | C#CCNC(C(=O)OCC)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F3NO3/c1-3-9-18-12(13(19)20-4-2)10-5-7-11(8-6-10)21-14(15,16)17/h1,5-8,12,18H,4,9H2,2H3 |
| InChIKey | NMHNIYSJDGJMHL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|