C13H13ClFNO2 — CID 81145682
ethyl 2-(3-chloro-4-fluorophenyl)-2-(prop-2-ynylamino)acetate (PubChem CID 81145682) has the molecular formula C13H13ClFNO2 and a molecular weight of 269.70 g/mol. Its IUPAC name is ethyl 2-(3-chloro-4-fluorophenyl)-2-(prop-2-ynylamino)acetate.
| Compound Name | ethyl 2-(3-chloro-4-fluorophenyl)-2-(prop-2-ynylamino)acetate |
|---|---|
| PubChem CID | 81145682 |
| Molecular Formula | C13H13ClFNO2 |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | ethyl 2-(3-chloro-4-fluorophenyl)-2-(prop-2-ynylamino)acetate |
| SMILES | C#CCNC(C(=O)OCC)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClFNO2/c1-3-7-16-12(13(17)18-4-2)9-5-6-11(15)10(14)8-9/h1,5-6,8,12,16H,4,7H2,2H3 |
| InChIKey | WLDHCZJNZDHBJM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|