C9H11N7 — CID 62369554
1-phenyl-2-(2H-tetrazol-5-ylmethyl)guanidine (PubChem CID 62369554) has the molecular formula C9H11N7 and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-phenyl-2-(2H-tetrazol-5-ylmethyl)guanidine.
| Compound Name | 1-phenyl-2-(2H-tetrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 62369554 |
| Molecular Formula | C9H11N7 |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-phenyl-2-(2H-tetrazol-5-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1nn[nH]n1)Nc1ccccc1 |
| InChI | InChI=1S/C9H11N7/c10-9(11-6-8-13-15-16-14-8)12-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12)(H,13,14,15,16) |
| InChIKey | AMCCSBIZGBQVQN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|