C14H21NO3 — CID 62374074
3-ethyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62374074) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-ethyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-ethyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62374074 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-ethyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCC1Cc2c(OC)cc(OC)c(OC)c2CN1 |
| InChI | InChI=1S/C14H21NO3/c1-5-9-6-10-11(8-15-9)14(18-4)13(17-3)7-12(10)16-2/h7,9,15H,5-6,8H2,1-4H3 |
| InChIKey | AMZZBBZPSHYLLL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |